brancalouis5 brancalouis5

03-02-2022
Mathematics

contestada

Which of this is equivilent to the expression s+s+s+s+12

Respuesta :

vasquezjohnathan vasquezjohnathan

03-02-2022

4s + 12 or 4(s + 3) would be equivalent to the expression!

Answer Link

Otras preguntas

What does weight training use? flexibilty of muscle control

A rod on a compressed spring exerts 12 N of force on a 0.05-kg steel ball. The rod pushes the ball 0.03 m. How much work does the spring do on the ball? A) 36 B

Euphrosynelight needs 2x-7 while her friend needs 5x+2 how much in total

what role did continuity play in early Chinese history

Approximately what is the length of the rope for the kite sail, in order to pull the ship at an angle of 45° and be at a vertical height of 150 m, as shown in t

Given the graph, find an equation for the parabola.

David is selling floral arrangements. Each arrangement uses 1 vase and 12 roses. Each vase costs David $2.00. Let C be the total cost of the arrangement and r b

Match the banking term with its definition.A. List currency coin and checks deposits into an accountB. A document signed by the depositor instructing the bank

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Your computer has been operating without problems for some time, but on your most recent startup, nothing appears on the monitor screen. The lights for the keyb